C22H27FN6O4 — CID 10310622
N-[[(5S)-3-[3-fluoro-4-[4-[[5-[(E)-hydrazinylidenemethyl]furan-2-yl]methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10310622) has the molecular formula C22H27FN6O4 and a molecular weight of 458.49 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[[5-[(E)-hydrazinylidenemethyl]furan-2-yl]methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[[5-[(E)-hydrazinylidenemethyl]furan-2-yl]methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10310622 |
| Molecular Formula | C22H27FN6O4 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[[5-[(E)-hydrazinylidenemethyl]furan-2-yl]methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(Cc4ccc(/C=N/N)o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H27FN6O4/c1-15(30)25-11-19-14-29(22(31)33-19)16-2-5-21(20(23)10-16)28-8-6-27(7-9-28)13-18-4-3-17(32-18)12-26-24/h2-5,10,12,19H,6-9,11,13-14,24H2,1H3,(H,25,30)/b26-12+/t19-/m0/s1 |
| InChIKey | QQSCLPPGKNFGEN-XDWZDTHNSA-N |
| XLogP | 1.49 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|