C21H25FN4O3S — CID 10296473
N-[[3-[3-fluoro-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10296473) has the molecular formula C21H25FN4O3S and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10296473 |
| Molecular Formula | C21H25FN4O3S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(Cc4cccs4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H25FN4O3S/c1-15(27)23-12-17-13-26(21(28)29-17)16-4-5-20(19(22)11-16)25-8-6-24(7-9-25)14-18-3-2-10-30-18/h2-5,10-11,17H,6-9,12-14H2,1H3,(H,23,27) |
| InChIKey | ZEROSNDUUKVDAW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|