C23H25FN4O3S — CID 59754022
N-[[(5S)-3-[3-fluoro-4-[4-[isocyano(thiophen-2-yl)methyl]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 59754022) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[isocyano(thiophen-2-yl)methyl]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[isocyano(thiophen-2-yl)methyl]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 59754022 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[isocyano(thiophen-2-yl)methyl]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [C-]#[N+]C(c1cccs1)C1CCN(c2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H25FN4O3S/c1-15(29)26-13-18-14-28(23(30)31-18)17-5-6-20(19(24)12-17)27-9-7-16(8-10-27)22(25-2)21-4-3-11-32-21/h3-6,11-12,16,18,22H,7-10,13-14H2,1H3,(H,26,29)/t18-,22?/m0/s1 |
| InChIKey | HFPLROPWPFQJIK-HXBUSHRASA-N |
| XLogP | 4.23 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|