C22H22F2N2O6S — CID 87630050
2-[3-[3-fluoro-4-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid (PubChem CID 87630050) has the molecular formula C22H22F2N2O6S and a molecular weight of 480.49 g/mol. Its IUPAC name is 2-[3-[3-fluoro-4-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid.
| Compound Name | 2-[3-[3-fluoro-4-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87630050 |
| Molecular Formula | C22H22F2N2O6S |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[3-[3-fluoro-4-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid |
| SMILES | O=C1CCN(c2ccc(-c3ccc(N4CC(CCS(=O)(=O)O)OC4=O)cc3F)cc2F)CC1 |
| InChI | InChI=1S/C22H22F2N2O6S/c23-19-12-15(26-13-17(32-22(26)28)7-10-33(29,30)31)2-3-18(19)14-1-4-21(20(24)11-14)25-8-5-16(27)6-9-25/h1-4,11-12,17H,5-10,13H2,(H,29,30,31) |
| InChIKey | NLUGLFDZTKGPCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|