C25H29F2N3O5 — CID 68943843
N-[[3-[4-[4-(4,4-dimethoxypiperidin-1-yl)-3-fluorophenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 68943843) has the molecular formula C25H29F2N3O5 and a molecular weight of 489.52 g/mol. Its IUPAC name is N-[[3-[4-[4-(4,4-dimethoxypiperidin-1-yl)-3-fluorophenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[4-(4,4-dimethoxypiperidin-1-yl)-3-fluorophenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 68943843 |
| Molecular Formula | C25H29F2N3O5 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[[3-[4-[4-(4,4-dimethoxypiperidin-1-yl)-3-fluorophenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COC1(OC)CCN(c2ccc(-c3ccc(N4CC(CNC(C)=O)OC4=O)cc3F)cc2F)CC1 |
| InChI | InChI=1S/C25H29F2N3O5/c1-16(31)28-14-19-15-30(24(32)35-19)18-5-6-20(21(26)13-18)17-4-7-23(22(27)12-17)29-10-8-25(33-2,34-3)9-11-29/h4-7,12-13,19H,8-11,14-15H2,1-3H3,(H,28,31) |
| InChIKey | DFGSNFLKSXBTJY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|