C28H28FN5O6 — CID 11444213
(E)-N-[[3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 11444213) has the molecular formula C28H28FN5O6 and a molecular weight of 549.56 g/mol. Its IUPAC name is (E)-N-[[3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11444213 |
| Molecular Formula | C28H28FN5O6 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (E)-N-[[3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC1CN(c2ccc(N3CCN(Cc4ccc([N+](=O)[O-])o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C28H28FN5O6/c29-24-16-21(33-19-23(40-28(33)36)17-30-26(35)10-6-20-4-2-1-3-5-20)7-9-25(24)32-14-12-31(13-15-32)18-22-8-11-27(39-22)34(37)38/h1-11,16,23H,12-15,17-19H2,(H,30,35)/b10-6+ |
| InChIKey | BSYPZQNFVRYLRT-UXBLZVDNSA-N |
| XLogP | 3.80 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|