C16H19FN2O5S2-2 — CID 22140934
N-[[3-[4-(2,2-dioxidooxathian-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 22140934) has the molecular formula C16H19FN2O5S2-2 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[[3-[4-(2,2-dioxidooxathian-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[3-[4-(2,2-dioxidooxathian-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 22140934 |
| Molecular Formula | C16H19FN2O5S2-2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-[[3-[4-(2,2-dioxidooxathian-5-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCC1CN(c2ccc(C3CCS([O-])([O-])OC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H21FN2O5S2/c1-10(25)18-7-13-8-19(16(20)24-13)12-2-3-14(15(17)6-12)11-4-5-26(21,22)23-9-11/h2-3,6,11,13,21-22H,4-5,7-9H2,1H3,(H,18,25)/p-2 |
| InChIKey | DRFLGSBOHPVMSG-UHFFFAOYSA-L |
| XLogP | 2.57 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|