C19H25FN2O8S — CID 69355344
[(5S)-3-[4-(1,1-dihydroxythian-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyloxymethyl acetate (PubChem CID 69355344) has the molecular formula C19H25FN2O8S and a molecular weight of 460.48 g/mol. Its IUPAC name is [(5S)-3-[4-(1,1-dihydroxythian-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyloxymethyl acetate.
| Compound Name | [(5S)-3-[4-(1,1-dihydroxythian-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyloxymethyl acetate |
|---|---|
| PubChem CID | 69355344 |
| Molecular Formula | C19H25FN2O8S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [(5S)-3-[4-(1,1-dihydroxythian-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylcarbamoyloxymethyl acetate |
| SMILES | CC(=O)OCOC(=O)NC[C@H]1CN(c2ccc(C3CCS(O)(O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H25FN2O8S/c1-12(23)28-11-29-18(24)21-9-15-10-22(19(25)30-15)14-2-3-16(17(20)8-14)13-4-6-31(26,27)7-5-13/h2-3,8,13,15,26-27H,4-7,9-11H2,1H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | MRQCTAJMHMMHLK-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|