C20H19FN6O2S — CID 11560943
1-[[(5S)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-cyclopropylthiourea (PubChem CID 11560943) has the molecular formula C20H19FN6O2S and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-[[(5S)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-cyclopropylthiourea.
| Compound Name | 1-[[(5S)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 11560943 |
| Molecular Formula | C20H19FN6O2S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[[(5S)-3-[4-(benzotriazol-1-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-3-cyclopropylthiourea |
| SMILES | O=C1O[C@@H](CNC(=S)NC2CC2)CN1c1ccc(-n2nnc3ccccc32)c(F)c1 |
| InChI | InChI=1S/C20H19FN6O2S/c21-15-9-13(7-8-17(15)27-18-4-2-1-3-16(18)24-25-27)26-11-14(29-20(26)28)10-22-19(30)23-12-5-6-12/h1-4,7-9,12,14H,5-6,10-11H2,(H2,22,23,30)/t14-/m0/s1 |
| InChIKey | RPOMVOMHEMXYHX-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|