C22H24FN7O7S — CID 126540167
N-[2-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-5-nitrofuran-2-carboxamide (PubChem CID 126540167) has the molecular formula C22H24FN7O7S and a molecular weight of 549.54 g/mol. Its IUPAC name is N-[2-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 126540167 |
| Molecular Formula | C22H24FN7O7S |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | N-[2-[4-[4-[(5S)-5-[(carbamothioylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-2-oxoethyl]-5-nitrofuran-2-carboxamide |
| SMILES | NC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=O)CNC(=O)c4ccc([N+](=O)[O-])o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H24FN7O7S/c23-15-9-13(29-12-14(36-22(29)33)10-26-21(24)38)1-2-16(15)27-5-7-28(8-6-27)18(31)11-25-20(32)17-3-4-19(37-17)30(34)35/h1-4,9,14H,5-8,10-12H2,(H,25,32)(H3,24,26,38)/t14-/m0/s1 |
| InChIKey | UGOWRNDJVDBGGO-AWEZNQCLSA-N |
| XLogP | 0.56 |
| TPSA | 176.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|