C16H20FN5O4 — CID 88931232
N-[[(5S)-3-[3-fluoro-4-[2-formamidoethyl(methanimidoyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 88931232) has the molecular formula C16H20FN5O4 and a molecular weight of 365.37 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[2-formamidoethyl(methanimidoyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[2-formamidoethyl(methanimidoyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88931232 |
| Molecular Formula | C16H20FN5O4 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[2-formamidoethyl(methanimidoyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | [H]/N=C/N(CCNC=O)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C16H20FN5O4/c1-11(24)20-7-13-8-22(16(25)26-13)12-2-3-15(14(17)6-12)21(9-18)5-4-19-10-23/h2-3,6,9-10,13,18H,4-5,7-8H2,1H3,(H,19,23)(H,20,24)/b18-9+/t13-/m0/s1 |
| InChIKey | KFQGHSMHSJSFLX-VVSAQIQQSA-N |
| XLogP | 0.45 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|