C17H20FN3O4S — CID 142967147
tert-butyl N-[2-fluoro-4-[(5R)-5-(isothiocyanatomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-methylcarbamate (PubChem CID 142967147) has the molecular formula C17H20FN3O4S and a molecular weight of 381.43 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-[(5R)-5-(isothiocyanatomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-[(5R)-5-(isothiocyanatomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142967147 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-[(5R)-5-(isothiocyanatomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(N2C[C@H](CN=C=S)OC2=O)cc1F |
| InChI | InChI=1S/C17H20FN3O4S/c1-17(2,3)25-15(22)20(4)14-6-5-11(7-13(14)18)21-9-12(8-19-10-26)24-16(21)23/h5-7,12H,8-9H2,1-4H3/t12-/m0/s1 |
| InChIKey | JSNPNXZSJGZSBS-LBPRGKRZSA-N |
| XLogP | 3.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|