C17H12FN5O2S — CID 11545161
(5R)-3-[4-(benzotriazol-2-yl)-3-fluorophenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one (PubChem CID 11545161) has the molecular formula C17H12FN5O2S and a molecular weight of 369.38 g/mol. Its IUPAC name is (5R)-3-[4-(benzotriazol-2-yl)-3-fluorophenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-(benzotriazol-2-yl)-3-fluorophenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11545161 |
| Molecular Formula | C17H12FN5O2S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (5R)-3-[4-(benzotriazol-2-yl)-3-fluorophenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](CN=C=S)CN1c1ccc(-n2nc3ccccc3n2)c(F)c1 |
| InChI | InChI=1S/C17H12FN5O2S/c18-13-7-11(22-9-12(8-19-10-26)25-17(22)24)5-6-16(13)23-20-14-3-1-2-4-15(14)21-23/h1-7,12H,8-9H2/t12-/m0/s1 |
| InChIKey | RGDCDNCEFJXBIR-LBPRGKRZSA-N |
| XLogP | 2.99 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|