C16H18FN3O3S2 — CID 22943614
3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one (PubChem CID 22943614) has the molecular formula C16H18FN3O3S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 22943614 |
| Molecular Formula | C16H18FN3O3S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-5-(isothiocyanatomethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CN=C=S)CN1c1ccc(N2CCCS(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C16H18FN3O3S2/c17-14-8-12(20-10-13(9-18-11-24)23-16(20)21)2-3-15(14)19-4-1-6-25(22)7-5-19/h2-3,8,13H,1,4-7,9-10H2 |
| InChIKey | UYYXADAEJZDZMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|