C15H20FN3O5S2 — CID 126496005
N-[[3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide (PubChem CID 126496005) has the molecular formula C15H20FN3O5S2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 126496005 |
| Molecular Formula | C15H20FN3O5S2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[[3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CN(c2ccc(N3CCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H20FN3O5S2/c1-26(22,23)17-9-12-10-19(15(20)24-12)11-2-3-14(13(16)8-11)18-4-6-25(21)7-5-18/h2-3,8,12,17H,4-7,9-10H2,1H3 |
| InChIKey | CFTHGZKOUCUFHC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|