C17H22FN3O4S — CID 166925912
N-[2-[(5S)-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethyl]acetamide (PubChem CID 166925912) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[2-[(5S)-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethyl]acetamide.
| Compound Name | N-[2-[(5S)-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 166925912 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[2-[(5S)-3-[3-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethyl]acetamide |
| SMILES | CC(=O)NCC[C@H]1CN(c2ccc(N3CCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H22FN3O4S/c1-12(22)19-5-4-14-11-21(17(23)25-14)13-2-3-16(15(18)10-13)20-6-8-26(24)9-7-20/h2-3,10,14H,4-9,11H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | MOJQDZGRWHRWHB-AWEZNQCLSA-N |
| XLogP | 1.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|