C16H19FN2O5S — CID 11624886
methyl (5R)-3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate (PubChem CID 11624886) has the molecular formula C16H19FN2O5S and a molecular weight of 370.40 g/mol. Its IUPAC name is methyl (5R)-3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl (5R)-3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 11624886 |
| Molecular Formula | C16H19FN2O5S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | methyl (5R)-3-[3-fluoro-4-(1-oxo-1,4-thiazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@H]1CN(c2ccc(N3CCCS(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H19FN2O5S/c1-23-15(20)14-10-19(16(21)24-14)11-3-4-13(12(17)9-11)18-5-2-7-25(22)8-6-18/h3-4,9,14H,2,5-8,10H2,1H3/t14-,25?/m1/s1 |
| InChIKey | PCTJIDVCIGKRHO-SUUGVPPDSA-N |
| XLogP | 1.28 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|