C15H18FN3O4 — CID 69022376
3-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 69022376) has the molecular formula C15H18FN3O4 and a molecular weight of 323.32 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | 3-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 69022376 |
| Molecular Formula | C15H18FN3O4 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | NC(=O)C1CN(c2ccc(N3CCCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H18FN3O4/c16-11-8-10(19-9-13(14(17)20)23-15(19)21)2-3-12(11)18-4-1-6-22-7-5-18/h2-3,8,13H,1,4-7,9H2,(H2,17,20) |
| InChIKey | HEAVHUIRLVOPBK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|