C19H28ClFN4O4S — CID 142826157
4-[[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]methylsulfanyl]butanamide;hydrochloride (PubChem CID 142826157) has the molecular formula C19H28ClFN4O4S and a molecular weight of 462.98 g/mol. Its IUPAC name is 4-[[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]methylsulfanyl]butanamide;hydrochloride.
| Compound Name | 4-[[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]methylsulfanyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 142826157 |
| Molecular Formula | C19H28ClFN4O4S |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[[[(5S)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]methylsulfanyl]butanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCSCNC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H27FN4O4S.ClH/c20-16-10-14(3-4-17(16)23-5-7-27-8-6-23)24-12-15(28-19(24)26)11-22-13-29-9-1-2-18(21)25;/h3-4,10,15,22H,1-2,5-9,11-13H2,(H2,21,25);1H/t15-;/m0./s1 |
| InChIKey | YNHYEQBRKBBVRZ-RSAXXLAASA-N |
| XLogP | 1.96 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|