C15H19FN4O4S — CID 174371329
[3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylsulfanylurea (PubChem CID 174371329) has the molecular formula C15H19FN4O4S and a molecular weight of 370.41 g/mol. Its IUPAC name is [3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylsulfanylurea.
| Compound Name | [3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylsulfanylurea |
|---|---|
| PubChem CID | 174371329 |
| Molecular Formula | C15H19FN4O4S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylsulfanylurea |
| SMILES | NC(=O)NSCC1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H19FN4O4S/c16-12-7-10(1-2-13(12)19-3-5-23-6-4-19)20-8-11(24-15(20)22)9-25-18-14(17)21/h1-2,7,11H,3-6,8-9H2,(H3,17,18,21) |
| InChIKey | BYHMVYHKWRBARD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|