C14H16FNO4 — CID 141011533
tert-butyl 2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)benzoate (PubChem CID 141011533) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is tert-butyl 2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)benzoate.
| Compound Name | tert-butyl 2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)benzoate |
|---|---|
| PubChem CID | 141011533 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | tert-butyl 2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N2CCOC2=O)cc1F |
| InChI | InChI=1S/C14H16FNO4/c1-14(2,3)20-12(17)10-5-4-9(8-11(10)15)16-6-7-19-13(16)18/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | NEUFRYKTHOBVDI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |