C13H16FN3O2 — CID 20785452
3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 20785452) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 20785452 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-(3-fluoro-4-piperazin-1-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccc(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C13H16FN3O2/c14-11-9-10(17-7-8-19-13(17)18)1-2-12(11)16-5-3-15-4-6-16/h1-2,9,15H,3-8H2 |
| InChIKey | RIODZOKLWXDXGP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|