C13H17FN4O — CID 20785321
1-(3-fluoro-4-piperazin-1-ylphenyl)imidazolidin-2-one (PubChem CID 20785321) has the molecular formula C13H17FN4O and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-(3-fluoro-4-piperazin-1-ylphenyl)imidazolidin-2-one.
| Compound Name | 1-(3-fluoro-4-piperazin-1-ylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 20785321 |
| Molecular Formula | C13H17FN4O |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(3-fluoro-4-piperazin-1-ylphenyl)imidazolidin-2-one |
| SMILES | O=C1NCCN1c1ccc(N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C13H17FN4O/c14-11-9-10(18-8-5-16-13(18)19)1-2-12(11)17-6-3-15-4-7-17/h1-2,9,15H,3-8H2,(H,16,19) |
| InChIKey | PCTSSPZMYYIMFC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|