C10H11BrFNO5S — CID 158400380
3-(4-bromo-3-fluorophenyl)-1,3-oxazolidin-2-one;methanesulfonic acid (PubChem CID 158400380) has the molecular formula C10H11BrFNO5S and a molecular weight of 356.17 g/mol. Its IUPAC name is 3-(4-bromo-3-fluorophenyl)-1,3-oxazolidin-2-one;methanesulfonic acid.
| Compound Name | 3-(4-bromo-3-fluorophenyl)-1,3-oxazolidin-2-one;methanesulfonic acid |
|---|---|
| PubChem CID | 158400380 |
| Molecular Formula | C10H11BrFNO5S |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 3-(4-bromo-3-fluorophenyl)-1,3-oxazolidin-2-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C1OCCN1c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C9H7BrFNO2.CH4O3S/c10-7-2-1-6(5-8(7)11)12-3-4-14-9(12)13;1-5(2,3)4/h1-2,5H,3-4H2;1H3,(H,2,3,4) |
| InChIKey | GYAMFBJKUNRSQO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|