C21H28FNO2 — CID 142959710
ethane;3-[3-fluoro-4-(2-phenylethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 142959710) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is ethane;3-[3-fluoro-4-(2-phenylethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;3-[3-fluoro-4-(2-phenylethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142959710 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | ethane;3-[3-fluoro-4-(2-phenylethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC.CC.O=C1OCCN1c1ccc(CCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C17H16FNO2.2C2H6/c18-16-12-15(19-10-11-21-17(19)20)9-8-14(16)7-6-13-4-2-1-3-5-13;2*1-2/h1-5,8-9,12H,6-7,10-11H2;2*1-2H3 |
| InChIKey | PAZXNWSRNDCIMH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |