C18H18FN3O3 — CID 142694832
4-[2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-N',N'-dimethylbenzohydrazide (PubChem CID 142694832) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is 4-[2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-[2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 142694832 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[2-fluoro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(-c2ccc(N3CCOC3=O)cc2F)cc1 |
| InChI | InChI=1S/C18H18FN3O3/c1-21(2)20-17(23)13-5-3-12(4-6-13)15-8-7-14(11-16(15)19)22-9-10-25-18(22)24/h3-8,11H,9-10H2,1-2H3,(H,20,23) |
| InChIKey | UFXXDBUUNSHJNO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|