C14H18N2O3 — CID 52587818
N,N-diethyl-4-(2-oxo-1,3-oxazolidin-3-yl)benzamide (PubChem CID 52587818) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N,N-diethyl-4-(2-oxo-1,3-oxazolidin-3-yl)benzamide.
| Compound Name | N,N-diethyl-4-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 52587818 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N,N-diethyl-4-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-15(4-2)13(17)11-5-7-12(8-6-11)16-9-10-19-14(16)18/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | ZVIWGTXOAAWXKV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |