C20H16N2O5 — CID 90551288
N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 90551288) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 90551288 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCOC2=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16N2O5/c23-19(15-5-8-17-18(12-15)27-13-26-17)21-9-1-2-14-3-6-16(7-4-14)22-10-11-25-20(22)24/h3-8,12H,9-11,13H2,(H,21,23) |
| InChIKey | PVJBAXKKIAFVJG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|