C19H14F2N2O3 — CID 90551302
2,6-difluoro-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]benzamide (PubChem CID 90551302) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 2,6-difluoro-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90551302 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2,6-difluoro-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCOC2=O)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H14F2N2O3/c20-15-4-1-5-16(21)17(15)18(24)22-10-2-3-13-6-8-14(9-7-13)23-11-12-26-19(23)25/h1,4-9H,10-12H2,(H,22,24) |
| InChIKey | JMEYULZNVOZUCC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|