C21H18F2N2O2 — CID 90551027
2,6-difluoro-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide (PubChem CID 90551027) has the molecular formula C21H18F2N2O2 and a molecular weight of 368.38 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 2,6-difluoro-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90551027 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2,6-difluoro-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCCCC2=O)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H18F2N2O2/c22-17-6-3-7-18(23)20(17)21(27)24-13-4-5-15-9-11-16(12-10-15)25-14-2-1-8-19(25)26/h3,6-7,9-12H,1-2,8,13-14H2,(H,24,27) |
| InChIKey | DLXPUJDCZCKSRW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|