C19H18N4O3 — CID 90550936
6-oxo-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1H-pyridazine-3-carboxamide (PubChem CID 90550936) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 6-oxo-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90550936 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 6-oxo-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCCCC2=O)cc1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C19H18N4O3/c24-17-11-10-16(21-22-17)19(26)20-12-3-4-14-6-8-15(9-7-14)23-13-2-1-5-18(23)25/h6-11H,1-2,5,12-13H2,(H,20,26)(H,22,24) |
| InChIKey | IZKDXUSZPGBJHD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|