C24H21N3O3 — CID 90551130
N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 90551130) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90551130 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCCCC2=O)cc1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C24H21N3O3/c28-23-10-4-5-16-27(23)20-13-11-18(12-14-20)7-6-15-25-24(29)21-17-22(30-26-21)19-8-2-1-3-9-19/h1-3,8-9,11-14,17H,4-5,10,15-16H2,(H,25,29) |
| InChIKey | LKUPEOBDLSGIHH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|