C19H19N3O3 — CID 90551143
5-methyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1,2-oxazole-3-carboxamide (PubChem CID 90551143) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5-methyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90551143 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5-methyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC#Cc2ccc(N3CCCCC3=O)cc2)no1 |
| InChI | InChI=1S/C19H19N3O3/c1-14-13-17(21-25-14)19(24)20-11-4-5-15-7-9-16(10-8-15)22-12-3-2-6-18(22)23/h7-10,13H,2-3,6,11-12H2,1H3,(H,20,24) |
| InChIKey | VZFDQJWEWDBOPJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|