C22H21ClN2O3 — CID 90551033
5-chloro-2-methoxy-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide (PubChem CID 90551033) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90551033 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 5-chloro-2-methoxy-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCC#Cc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-28-20-12-9-17(23)15-19(20)22(27)24-13-4-5-16-7-10-18(11-8-16)25-14-3-2-6-21(25)26/h7-12,15H,2-3,6,13-14H2,1H3,(H,24,27) |
| InChIKey | AEJKAVFGSXUWSZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|