C23H24N2O2S — CID 90551070
2-benzylsulfanyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]acetamide (PubChem CID 90551070) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90551070 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-benzylsulfanyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]acetamide |
| SMILES | O=C(CSCc1ccccc1)NCC#Cc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c26-22(18-28-17-20-7-2-1-3-8-20)24-15-6-9-19-11-13-21(14-12-19)25-16-5-4-10-23(25)27/h1-3,7-8,11-14H,4-5,10,15-18H2,(H,24,26) |
| InChIKey | QBFXKINHOIKLQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|