C18H18N4O3S — CID 90551435
N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-4-propylthiadiazole-5-carboxamide (PubChem CID 90551435) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 90551435 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NCC#Cc1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-2-4-15-16(26-21-20-15)17(23)19-10-3-5-13-6-8-14(9-7-13)22-11-12-25-18(22)24/h6-9H,2,4,10-12H2,1H3,(H,19,23) |
| InChIKey | QVUWTJMHPJPPRJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|