C21H21N3O4 — CID 90554067
1-(2-ethoxyphenyl)-3-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]urea (PubChem CID 90554067) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 90554067 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]urea |
| SMILES | CCOc1ccccc1NC(=O)NCC#Cc1ccc(N2CCOC2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-2-27-19-8-4-3-7-18(19)23-20(25)22-13-5-6-16-9-11-17(12-10-16)24-14-15-28-21(24)26/h3-4,7-12H,2,13-15H2,1H3,(H2,22,23,25) |
| InChIKey | MIOXDWFYAKBNKH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|