C23H20FN3O4 — CID 90551382
1-(4-fluorophenyl)-5-oxo-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide (PubChem CID 90551382) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-oxo-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-oxo-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90551382 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-oxo-N-[3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccc(N2CCOC2=O)cc1)C1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H20FN3O4/c24-18-5-9-20(10-6-18)27-15-17(14-21(27)28)22(29)25-11-1-2-16-3-7-19(8-4-16)26-12-13-31-23(26)30/h3-10,17H,11-15H2,(H,25,29) |
| InChIKey | VOSIULSXPDOKBF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|