C20H17FN2O2 — CID 90548213
N-[3-(4-fluorophenyl)prop-2-ynyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 90548213) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)prop-2-ynyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[3-(4-fluorophenyl)prop-2-ynyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90548213 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[3-(4-fluorophenyl)prop-2-ynyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccc(F)cc1)C1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C20H17FN2O2/c21-17-10-8-15(9-11-17)5-4-12-22-20(25)16-13-19(24)23(14-16)18-6-2-1-3-7-18/h1-3,6-11,16H,12-14H2,(H,22,25) |
| InChIKey | JJJPCFQXFYKUFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|