C21H16F4N2O2 — CID 90550599
1-(4-fluorophenyl)-5-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide (PubChem CID 90550599) has the molecular formula C21H16F4N2O2 and a molecular weight of 404.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90550599 |
| Molecular Formula | C21H16F4N2O2 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-(4-fluorophenyl)-5-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)C1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H16F4N2O2/c22-17-6-8-18(9-7-17)27-13-15(12-19(27)28)20(29)26-10-2-4-14-3-1-5-16(11-14)21(23,24)25/h1,3,5-9,11,15H,10,12-13H2,(H,26,29) |
| InChIKey | GBXKMHSRSMHDEI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|