C23H21F3N2O3 — CID 90575918
1-(4-methylphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide (PubChem CID 90575918) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90575918 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-(4-methylphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)NCC#CCOc3cccc(C(F)(F)F)c3)CC2=O)cc1 |
| InChI | InChI=1S/C23H21F3N2O3/c1-16-7-9-19(10-8-16)28-15-17(13-21(28)29)22(30)27-11-2-3-12-31-20-6-4-5-18(14-20)23(24,25)26/h4-10,14,17H,11-13,15H2,1H3,(H,27,30) |
| InChIKey | KYEOSDUADVOFMG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|