C23H21F3N2O4 — CID 90575920
1-(4-methoxyphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide (PubChem CID 90575920) has the molecular formula C23H21F3N2O4 and a molecular weight of 446.43 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90575920 |
| Molecular Formula | C23H21F3N2O4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-oxo-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)NCC#CCOc3cccc(C(F)(F)F)c3)CC2=O)cc1 |
| InChI | InChI=1S/C23H21F3N2O4/c1-31-19-9-7-18(8-10-19)28-15-16(13-21(28)29)22(30)27-11-2-3-12-32-20-6-4-5-17(14-20)23(24,25)26/h4-10,14,16H,11-13,15H2,1H3,(H,27,30) |
| InChIKey | RRRQIRQJBNGXAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|