C21H20FN3O3 — CID 90579375
1-(4-fluorophenyl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 90579375) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90579375 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(OCC#CCNC(=O)C2CC(=O)N(c3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C21H20FN3O3/c1-15-4-9-19(13-24-15)28-11-3-2-10-23-21(27)16-12-20(26)25(14-16)18-7-5-17(22)6-8-18/h4-9,13,16H,10-12,14H2,1H3,(H,23,27) |
| InChIKey | OMUDVMMKTXJWQB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|