C17H22N2O — CID 78777192
4-(2,5-dimethylpyrrol-1-yl)-N,N-diethylbenzamide (PubChem CID 78777192) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N,N-diethylbenzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 78777192 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C17H22N2O/c1-5-18(6-2)17(20)15-9-11-16(12-10-15)19-13(3)7-8-14(19)4/h7-12H,5-6H2,1-4H3 |
| InChIKey | GOJMHADNULEWJP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|