C23H28FN5O3S — CID 143415420
5-[[ethyl-(methylideneamino)amino]methyl]-3-[3-fluoro-4-[5-methyl-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 143415420) has the molecular formula C23H28FN5O3S and a molecular weight of 473.57 g/mol. Its IUPAC name is 5-[[ethyl-(methylideneamino)amino]methyl]-3-[3-fluoro-4-[5-methyl-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[[ethyl-(methylideneamino)amino]methyl]-3-[3-fluoro-4-[5-methyl-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143415420 |
| Molecular Formula | C23H28FN5O3S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 5-[[ethyl-(methylideneamino)amino]methyl]-3-[3-fluoro-4-[5-methyl-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | C=NN(CC)CC1CN(c2ccc(-c3cnc(N4CCS(=O)CC4)c(C)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H28FN5O3S/c1-4-28(25-3)14-19-15-29(23(30)32-19)18-5-6-20(21(24)12-18)17-11-16(2)22(26-13-17)27-7-9-33(31)10-8-27/h5-6,11-13,19H,3-4,7-10,14-15H2,1-2H3 |
| InChIKey | ADSMHTNJIYKDHQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|