C21H31FN6O3 — CID 145042319
N'-[amino(methyl)amino]-5-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyridine-2-carboximidamide;ethane (PubChem CID 145042319) has the molecular formula C21H31FN6O3 and a molecular weight of 434.52 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-5-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyridine-2-carboximidamide;ethane.
| Compound Name | N'-[amino(methyl)amino]-5-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyridine-2-carboximidamide;ethane |
|---|---|
| PubChem CID | 145042319 |
| Molecular Formula | C21H31FN6O3 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N'-[amino(methyl)amino]-5-[2-fluoro-4-[5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]pyridine-2-carboximidamide;ethane |
| SMILES | CC.CC.CN(N)/N=C(\N)c1ccc(-c2ccc(N3CC(CO)OC3=O)cc2F)cn1 |
| InChI | InChI=1S/C17H19FN6O3.2C2H6/c1-23(20)22-16(19)15-5-2-10(7-21-15)13-4-3-11(6-14(13)18)24-8-12(9-25)27-17(24)26;2*1-2/h2-7,12,25H,8-9,20H2,1H3,(H2,19,22);2*1-2H3 |
| InChIKey | LQODQJGITQAKJY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|