C31H32FN6O6P — CID 145042305
[3-[4-[6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dibenzyl phosphate (PubChem CID 145042305) has the molecular formula C31H32FN6O6P and a molecular weight of 634.61 g/mol. Its IUPAC name is [3-[4-[6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dibenzyl phosphate.
| Compound Name | [3-[4-[6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dibenzyl phosphate |
|---|---|
| PubChem CID | 145042305 |
| Molecular Formula | C31H32FN6O6P |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | [3-[4-[6-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dibenzyl phosphate |
| SMILES | CN(N)/N=C(\N)c1ccc(-c2ccc(N3CC(COP(=O)(OCc4ccccc4)OCc4ccccc4)OC3=O)cc2F)cn1 |
| InChI | InChI=1S/C31H32FN6O6P/c1-37(34)36-30(33)29-15-12-24(17-35-29)27-14-13-25(16-28(27)32)38-18-26(44-31(38)39)21-43-45(40,41-19-22-8-4-2-5-9-22)42-20-23-10-6-3-7-11-23/h2-17,26H,18-21,34H2,1H3,(H2,33,36) |
| InChIKey | ZDQIFWFDNDEZJY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 154.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|