C18H21FN7O6P — CID 123405888
[3-[3-fluoro-4-[6-[methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate (PubChem CID 123405888) has the molecular formula C18H21FN7O6P and a molecular weight of 481.38 g/mol. Its IUPAC name is [3-[3-fluoro-4-[6-[methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[3-fluoro-4-[6-[methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 123405888 |
| Molecular Formula | C18H21FN7O6P |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | [3-[3-fluoro-4-[6-[methyl-[N'-(methyldiazenyl)carbamimidoyl]amino]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
| SMILES | C/N=N/N=C(N)N(C)c1ccc(-c2ccc(N3CC(COP(=O)(O)O)OC3=O)cc2F)cn1 |
| InChI | InChI=1S/C18H21FN7O6P/c1-21-24-23-17(20)25(2)16-6-3-11(8-22-16)14-5-4-12(7-15(14)19)26-9-13(32-18(26)27)10-31-33(28,29)30/h3-8,13H,9-10H2,1-2H3,(H2,20,21,23)(H2,28,29,30) |
| InChIKey | QGMBABWWUGZAPR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|