C25H30FN5O2S — CID 143415334
3-[3-fluoro-4-(6-thiomorpholin-4-yl-3-pyridinyl)phenyl]-5-[[[(Z)-3-methylbut-1-enyl]-(methylideneamino)amino]methyl]-1,3-oxazolidin-2-one (PubChem CID 143415334) has the molecular formula C25H30FN5O2S and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[3-fluoro-4-(6-thiomorpholin-4-yl-3-pyridinyl)phenyl]-5-[[[(Z)-3-methylbut-1-enyl]-(methylideneamino)amino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-fluoro-4-(6-thiomorpholin-4-yl-3-pyridinyl)phenyl]-5-[[[(Z)-3-methylbut-1-enyl]-(methylideneamino)amino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143415334 |
| Molecular Formula | C25H30FN5O2S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 3-[3-fluoro-4-(6-thiomorpholin-4-yl-3-pyridinyl)phenyl]-5-[[[(Z)-3-methylbut-1-enyl]-(methylideneamino)amino]methyl]-1,3-oxazolidin-2-one |
| SMILES | C=NN(/C=C\C(C)C)CC1CN(c2ccc(-c3ccc(N4CCSCC4)nc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H30FN5O2S/c1-18(2)8-9-30(27-3)16-21-17-31(25(32)33-21)20-5-6-22(23(26)14-20)19-4-7-24(28-15-19)29-10-12-34-13-11-29/h4-9,14-15,18,21H,3,10-13,16-17H2,1-2H3/b9-8- |
| InChIKey | CATRFEWVHBYNLJ-HJWRWDBZSA-N |
| XLogP | 4.85 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|