C25H28FN5O4 — CID 174461303
2-[3-[4-[6-[4-[(E)-but-2-enoyl]piperazin-1-yl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide (PubChem CID 174461303) has the molecular formula C25H28FN5O4 and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[3-[4-[6-[4-[(E)-but-2-enoyl]piperazin-1-yl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide.
| Compound Name | 2-[3-[4-[6-[4-[(E)-but-2-enoyl]piperazin-1-yl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
|---|---|
| PubChem CID | 174461303 |
| Molecular Formula | C25H28FN5O4 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[3-[4-[6-[4-[(E)-but-2-enoyl]piperazin-1-yl]-3-pyridinyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]propanamide |
| SMILES | C/C=C/C(=O)N1CCN(c2ccc(-c3ccc(N4CC(C(C)C(N)=O)OC4=O)cc3F)cn2)CC1 |
| InChI | InChI=1S/C25H28FN5O4/c1-3-4-23(32)30-11-9-29(10-12-30)22-8-5-17(14-28-22)19-7-6-18(13-20(19)26)31-15-21(35-25(31)34)16(2)24(27)33/h3-8,13-14,16,21H,9-12,15H2,1-2H3,(H2,27,33)/b4-3+ |
| InChIKey | UXZSIWQOBXJAJE-ONEGZZNKSA-N |
| XLogP | 2.56 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|